C18H23NO3S2 — CID 171478413
7-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]heptanoic acid (PubChem CID 171478413) has the molecular formula C18H23NO3S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 7-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]heptanoic acid.
| Compound Name | 7-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 171478413 |
| Molecular Formula | C18H23NO3S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 7-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]heptanoic acid |
| SMILES | Cc1ccc(/C=C2\SC(S)N(CCCCCCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C18H23NO3S2/c1-13-7-9-14(10-8-13)12-15-17(22)19(18(23)24-15)11-5-3-2-4-6-16(20)21/h7-10,12,18,23H,2-6,11H2,1H3,(H,20,21)/b15-12- |
| InChIKey | RIAQJRXSDHMDQY-QINSGFPZSA-N |
| XLogP | 4.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|