C21H28BrNO3S2 — CID 143086757
11-[(5Z)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]undecanoic acid (PubChem CID 143086757) has the molecular formula C21H28BrNO3S2 and a molecular weight of 486.50 g/mol. Its IUPAC name is 11-[(5Z)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]undecanoic acid.
| Compound Name | 11-[(5Z)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]undecanoic acid |
|---|---|
| PubChem CID | 143086757 |
| Molecular Formula | C21H28BrNO3S2 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 11-[(5Z)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCN1C(=O)/C(=C/c2cccc(Br)c2)SC1S |
| InChI | InChI=1S/C21H28BrNO3S2/c22-17-11-9-10-16(14-17)15-18-20(26)23(21(27)28-18)13-8-6-4-2-1-3-5-7-12-19(24)25/h9-11,14-15,21,27H,1-8,12-13H2,(H,24,25)/b18-15- |
| InChIKey | JJSFEMGKFYHWOE-SDXDJHTJSA-N |
| XLogP | 6.17 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|