C19H25NO3S2 — CID 171478348
7-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]heptanoic acid (PubChem CID 171478348) has the molecular formula C19H25NO3S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is 7-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]heptanoic acid.
| Compound Name | 7-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 171478348 |
| Molecular Formula | C19H25NO3S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 7-[(5Z)-5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanyl-1,3-thiazolidin-3-yl]heptanoic acid |
| SMILES | CCc1ccc(/C=C2\SC(S)N(CCCCCCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C19H25NO3S2/c1-2-14-8-10-15(11-9-14)13-16-18(23)20(19(24)25-16)12-6-4-3-5-7-17(21)22/h8-11,13,19,24H,2-7,12H2,1H3,(H,21,22)/b16-13- |
| InChIKey | RFGHJYGOVWJAGX-SSZFMOIBSA-N |
| XLogP | 4.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|