C45H42N2O — CID 163851609
6-cyclohexa-1,5-dien-1-yl-9-[9-(3-phenyl-3,4,7,8-tetrahydroisoquinolin-1-yl)-2,3,6,7,8,9-hexahydrodibenzofuran-4-yl]-3,4-dihydrocarbazole (PubChem CID 163851609) has the molecular formula C45H42N2O and a molecular weight of 626.84 g/mol. Its IUPAC name is 6-cyclohexa-1,5-dien-1-yl-9-[9-(3-phenyl-3,4,7,8-tetrahydroisoquinolin-1-yl)-2,3,6,7,8,9-hexahydrodibenzofuran-4-yl]-3,4-dihydrocarbazole.
| Compound Name | 6-cyclohexa-1,5-dien-1-yl-9-[9-(3-phenyl-3,4,7,8-tetrahydroisoquinolin-1-yl)-2,3,6,7,8,9-hexahydrodibenzofuran-4-yl]-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 163851609 |
| Molecular Formula | C45H42N2O |
| Molecular Weight | 626.84 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | 6-cyclohexa-1,5-dien-1-yl-9-[9-(3-phenyl-3,4,7,8-tetrahydroisoquinolin-1-yl)-2,3,6,7,8,9-hexahydrodibenzofuran-4-yl]-3,4-dihydrocarbazole |
| SMILES | C1=CC(c2ccc3c(c2)c2c(n3C3=c4oc5c(c4=CCC3)C(C3=NC(c4ccccc4)CC4=C3CCC=C4)CCC5)C=CCC2)=CCC1 |
| InChI | InChI=1S/C45H42N2O/c1-3-13-29(14-4-1)31-25-26-40-37(27-31)34-19-9-10-22-39(34)47(40)41-23-11-21-36-43-35(20-12-24-42(43)48-45(36)41)44-33-18-8-7-17-32(33)28-38(46-44)30-15-5-2-6-16-30/h2-3,5-7,10,13-17,21-22,25-27,35,38H,1,4,8-9,11-12,18-20,23-24,28H2 |
| InChIKey | OUVLVGPCSYCABO-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 30.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.84 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |