C60H48N4 — CID 163851877
2-[3-[3-[4-[cyclohepta-1,6-dien-1-yl(diphenyl)methyl]phenyl]phenyl]-5-(2,6-dimethyl-3-pyridinyl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 163851877) has the molecular formula C60H48N4 and a molecular weight of 825.07 g/mol. Its IUPAC name is 2-[3-[3-[4-[cyclohepta-1,6-dien-1-yl(diphenyl)methyl]phenyl]phenyl]-5-(2,6-dimethyl-3-pyridinyl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-[4-[cyclohepta-1,6-dien-1-yl(diphenyl)methyl]phenyl]phenyl]-5-(2,6-dimethyl-3-pyridinyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163851877 |
| Molecular Formula | C60H48N4 |
| Molecular Weight | 825.07 g/mol |
| Exact Mass | 824.39 |
| IUPAC Name | 2-[3-[3-[4-[cyclohepta-1,6-dien-1-yl(diphenyl)methyl]phenyl]phenyl]-5-(2,6-dimethyl-3-pyridinyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1ccc(-c2cc(-c3cccc(-c4ccc(C(C5=CCCCC=C5)(c5ccccc5)c5ccccc5)cc4)c3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c(C)n1 |
| InChI | InChI=1S/C60H48N4/c1-42-32-37-56(43(2)61-42)50-39-49(40-51(41-50)59-63-57(45-20-9-5-10-21-45)62-58(64-59)46-22-11-6-12-23-46)48-25-19-24-47(38-48)44-33-35-55(36-34-44)60(53-28-15-7-16-29-53,54-30-17-8-18-31-54)52-26-13-3-4-14-27-52/h5-13,15-41H,3-4,14H2,1-2H3 |
| InChIKey | OVBIAGACTXHGDF-UHFFFAOYSA-N |
| XLogP | 14.89 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.07 |
| LogP ≤ 5 | 14.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|