C18H23N — CID 163852785
N,2,3,4,6-pentamethyl-N-(3-methylphenyl)aniline (PubChem CID 163852785) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is N,2,3,4,6-pentamethyl-N-(3-methylphenyl)aniline.
| Compound Name | N,2,3,4,6-pentamethyl-N-(3-methylphenyl)aniline |
|---|---|
| PubChem CID | 163852785 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N,2,3,4,6-pentamethyl-N-(3-methylphenyl)aniline |
| SMILES | Cc1cccc(N(C)c2c(C)cc(C)c(C)c2C)c1 |
| InChI | InChI=1S/C18H23N/c1-12-8-7-9-17(10-12)19(6)18-14(3)11-13(2)15(4)16(18)5/h7-11H,1-6H3 |
| InChIKey | WOWQLBKOJOZNNO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |