C41H44O5 — CID 163853583
[4-[7-cyclohexa-2,4-dien-1-yl-2-(4-hydroxyphenyl)heptan-2-yl]phenyl] [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] carbonate (PubChem CID 163853583) has the molecular formula C41H44O5 and a molecular weight of 616.80 g/mol. Its IUPAC name is [4-[7-cyclohexa-2,4-dien-1-yl-2-(4-hydroxyphenyl)heptan-2-yl]phenyl] [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] carbonate.
| Compound Name | [4-[7-cyclohexa-2,4-dien-1-yl-2-(4-hydroxyphenyl)heptan-2-yl]phenyl] [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] carbonate |
|---|---|
| PubChem CID | 163853583 |
| Molecular Formula | C41H44O5 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | [4-[7-cyclohexa-2,4-dien-1-yl-2-(4-hydroxyphenyl)heptan-2-yl]phenyl] [4-[2-(4-hydroxyphenyl)propan-2-yl]phenyl] carbonate |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(OC(=O)Oc2ccc(C(C)(CCCCCC3C=CC=CC3)c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H44O5/c1-40(2,31-13-21-35(42)22-14-31)32-17-25-37(26-18-32)45-39(44)46-38-27-19-34(20-28-38)41(3,33-15-23-36(43)24-16-33)29-9-5-8-12-30-10-6-4-7-11-30/h4,6-7,10,13-28,30,42-43H,5,8-9,11-12,29H2,1-3H3 |
| InChIKey | OWKYSMSIOIYXNH-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|