C18H19NO2 — CID 163853601
(2E)-4-(cyclobutadienyl)-N-cyclobutyl-2-(cyclopenta-1,3-dien-1-ylmethylidene)-4-oxobutanamide (PubChem CID 163853601) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (2E)-4-(cyclobutadienyl)-N-cyclobutyl-2-(cyclopenta-1,3-dien-1-ylmethylidene)-4-oxobutanamide.
| Compound Name | (2E)-4-(cyclobutadienyl)-N-cyclobutyl-2-(cyclopenta-1,3-dien-1-ylmethylidene)-4-oxobutanamide |
|---|---|
| PubChem CID | 163853601 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2E)-4-(cyclobutadienyl)-N-cyclobutyl-2-(cyclopenta-1,3-dien-1-ylmethylidene)-4-oxobutanamide |
| SMILES | O=C(C/C(=C\C1=CC=CC1)C(=O)NC1CCC1)C1=CC=C1 |
| InChI | InChI=1S/C18H19NO2/c20-17(14-7-3-8-14)12-15(11-13-5-1-2-6-13)18(21)19-16-9-4-10-16/h1-3,5,7-8,11,16H,4,6,9-10,12H2,(H,19,21)/b15-11+ |
| InChIKey | OWLFCBPQTCUHNI-RVDMUPIBSA-N |
| XLogP | 2.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|