C26H32N5O5S+ — CID 163860498
[hydroxy-[8-(4-methylpiperazin-1-yl)-4-oxochromen-2-yl]methylidene]-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]azanium (PubChem CID 163860498) has the molecular formula C26H32N5O5S+ and a molecular weight of 526.64 g/mol. Its IUPAC name is [hydroxy-[8-(4-methylpiperazin-1-yl)-4-oxochromen-2-yl]methylidene]-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]azanium.
| Compound Name | [hydroxy-[8-(4-methylpiperazin-1-yl)-4-oxochromen-2-yl]methylidene]-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]azanium |
|---|---|
| PubChem CID | 163860498 |
| Molecular Formula | C26H32N5O5S+ |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | [hydroxy-[8-(4-methylpiperazin-1-yl)-4-oxochromen-2-yl]methylidene]-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]azanium |
| SMILES | CN1CCN(c2cccc3c(=O)cc(/C(O)=[NH+]/c4ccc(N5CCN(S(C)(=O)=O)CC5)cc4)oc23)CC1 |
| InChI | InChI=1S/C26H31N5O5S/c1-28-10-12-30(13-11-28)22-5-3-4-21-23(32)18-24(36-25(21)22)26(33)27-19-6-8-20(9-7-19)29-14-16-31(17-15-29)37(2,34)35/h3-9,18H,10-17H2,1-2H3,(H,27,33)/p+1 |
| InChIKey | PCCGRZHBZYAMQG-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|