C13H22N2O — CID 163862188
1-methoxy-N-[2-(4-methylidenecyclohexa-1,5-dien-1-yl)propyl]ethane-1,2-diamine (PubChem CID 163862188) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-methoxy-N-[2-(4-methylidenecyclohexa-1,5-dien-1-yl)propyl]ethane-1,2-diamine.
| Compound Name | 1-methoxy-N-[2-(4-methylidenecyclohexa-1,5-dien-1-yl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 163862188 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-methoxy-N-[2-(4-methylidenecyclohexa-1,5-dien-1-yl)propyl]ethane-1,2-diamine |
| SMILES | C=C1C=CC(C(C)CNC(CN)OC)=CC1 |
| InChI | InChI=1S/C13H22N2O/c1-10-4-6-12(7-5-10)11(2)9-15-13(8-14)16-3/h4,6-7,11,13,15H,1,5,8-9,14H2,2-3H3 |
| InChIKey | PDNARGKBMIAIJH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|