About N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine
N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine (PubChem CID 167001368) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine.
Molecular Properties
| Compound Name | N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine |
| PubChem CID | 167001368 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1=CC(C)[C@@H](C)C=C1 |
| InChI | InChI=1S/C12H21NO/c1-10-4-5-12(8-11(10)2)9-13-6-7-14-3/h4-5,8,10-11,13H,6-7,9H2,1-3H3/t10-,11?/m0/s1 |
| InChIKey | JGOQWUKTEIJQBI-VUWPPUDQSA-N |
| XLogP | 1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine?
The IUPAC name of N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine (CID 167001368) is N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine.
What is the SMILES notation for N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine?
The canonical SMILES for N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine is COCCNCC1=CC(C)[C@@H](C)C=C1.
What is the InChIKey of N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine?
The InChIKey is JGOQWUKTEIJQBI-VUWPPUDQSA-N. The full InChI is InChI=1S/C12H21NO/c1-10-4-5-12(8-11(10)2)9-13-6-7-14-3/h4-5,8,10-11,13H,6-7,9H2,1-3H3/t10-,11?/m0/s1.
What are the key properties of N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine?
N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine has a molecular weight of 195.31 g/mol, XLogP of 1.99, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]methyl]-2-methoxyethanamine is sourced from PubChem (CID 167001368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).