C11H21NO — CID 163863407
(4S,5S,6S,7R)-6-methoxy-4,5,7-trimethylcyclohepten-1-amine (PubChem CID 163863407) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (4S,5S,6S,7R)-6-methoxy-4,5,7-trimethylcyclohepten-1-amine.
| Compound Name | (4S,5S,6S,7R)-6-methoxy-4,5,7-trimethylcyclohepten-1-amine |
|---|---|
| PubChem CID | 163863407 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (4S,5S,6S,7R)-6-methoxy-4,5,7-trimethylcyclohepten-1-amine |
| SMILES | CO[C@H]1[C@@H](C)[C@@H](C)CC=C(N)[C@H]1C |
| InChI | InChI=1S/C11H21NO/c1-7-5-6-10(12)9(3)11(13-4)8(7)2/h6-9,11H,5,12H2,1-4H3/t7-,8-,9+,11-/m0/s1 |
| InChIKey | PENQSCINNCIVFW-CKEKPRIKSA-N |
| XLogP | 2.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |