C19H18N2O3S — CID 163867210
ethenyl 2-[(2-methylsulfanylpyridine-3-carbonyl)amino]-1,3-dihydroindene-2-carboxylate (PubChem CID 163867210) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is ethenyl 2-[(2-methylsulfanylpyridine-3-carbonyl)amino]-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethenyl 2-[(2-methylsulfanylpyridine-3-carbonyl)amino]-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 163867210 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | ethenyl 2-[(2-methylsulfanylpyridine-3-carbonyl)amino]-1,3-dihydroindene-2-carboxylate |
| SMILES | C=COC(=O)C1(NC(=O)c2cccnc2SC)Cc2ccccc2C1 |
| InChI | InChI=1S/C19H18N2O3S/c1-3-24-18(23)19(11-13-7-4-5-8-14(13)12-19)21-16(22)15-9-6-10-20-17(15)25-2/h3-10H,1,11-12H2,2H3,(H,21,22) |
| InChIKey | PHRBXNXUZFZJSD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|