C10H17F2NO — CID 163867787
(2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-4,4-difluoro-1-methylpyrrolidine (PubChem CID 163867787) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-4,4-difluoro-1-methylpyrrolidine.
| Compound Name | (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-4,4-difluoro-1-methylpyrrolidine |
|---|---|
| PubChem CID | 163867787 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-4,4-difluoro-1-methylpyrrolidine |
| SMILES | C/C=C(/C)OC[C@@H]1CC(F)(F)CN1C |
| InChI | InChI=1S/C10H17F2NO/c1-4-8(2)14-6-9-5-10(11,12)7-13(9)3/h4,9H,5-7H2,1-3H3/b8-4-/t9-/m0/s1 |
| InChIKey | PIDRPRWSLQRDLM-OTOXVQDCSA-N |
| XLogP | 2.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|