C17H22O — CID 163869120
5-(3-methylpentan-3-yl)-5H-benzo[7]annulen-7-ol (PubChem CID 163869120) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 5-(3-methylpentan-3-yl)-5H-benzo[7]annulen-7-ol.
| Compound Name | 5-(3-methylpentan-3-yl)-5H-benzo[7]annulen-7-ol |
|---|---|
| PubChem CID | 163869120 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 5-(3-methylpentan-3-yl)-5H-benzo[7]annulen-7-ol |
| SMILES | CCC(C)(CC)C1C=C(O)C=Cc2ccccc21 |
| InChI | InChI=1S/C17H22O/c1-4-17(3,5-2)16-12-14(18)11-10-13-8-6-7-9-15(13)16/h6-12,16,18H,4-5H2,1-3H3 |
| InChIKey | PJFVGHJETQERNG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |