About 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide
1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide (PubChem CID 157272134) has the molecular formula C11H14IN
and a molecular weight of 287.14 g/mol. Its IUPAC name is 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide.
Molecular Properties
| Compound Name | 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide |
| PubChem CID | 157272134 |
| Molecular Formula | C11H14IN |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide |
| SMILES | CC1c2ccccc2C=C[NH+]1C.[I-] |
| InChI | InChI=1S/C11H13N.HI/c1-9-11-6-4-3-5-10(11)7-8-12(9)2;/h3-9H,1-2H3;1H |
| InChIKey | AYQYJSSICODKMQ-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide?
The IUPAC name of 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide (CID 157272134) is 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide.
What is the SMILES notation for 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide?
The canonical SMILES for 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide is CC1c2ccccc2C=C[NH+]1C.[I-].
What is the InChIKey of 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide?
The InChIKey is AYQYJSSICODKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N.HI/c1-9-11-6-4-3-5-10(11)7-8-12(9)2;/h3-9H,1-2H3;1H.
What are the key properties of 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide?
1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide has a molecular weight of 287.14 g/mol, XLogP of -1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide is sourced from PubChem (CID 157272134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).