C11H14IN — CID 157272134
1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide (PubChem CID 157272134) has the molecular formula C11H14IN and a molecular weight of 287.14 g/mol. Its IUPAC name is 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide.
| Compound Name | 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide |
|---|---|
| PubChem CID | 157272134 |
| Molecular Formula | C11H14IN |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 1,2-dimethyl-1,2-dihydroisoquinolin-2-ium iodide |
| SMILES | CC1c2ccccc2C=C[NH+]1C.[I-] |
| InChI | InChI=1S/C11H13N.HI/c1-9-11-6-4-3-5-10(11)7-8-12(9)2;/h3-9H,1-2H3;1H |
| InChIKey | AYQYJSSICODKMQ-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|