C18H19Cl2Zr+ — CID 159935458
1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-1H-indene;zirconium(4+);dichloride (PubChem CID 159935458) has the molecular formula C18H19Cl2Zr+ and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-1H-indene;zirconium(4+);dichloride.
| Compound Name | 1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-1H-indene;zirconium(4+);dichloride |
|---|---|
| PubChem CID | 159935458 |
| Molecular Formula | C18H19Cl2Zr+ |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-1H-indene;zirconium(4+);dichloride |
| SMILES | Cc1c(C)c(C)[c-](C2C=Cc3ccccc32)c1C.[Cl-].[Cl-].[Zr+4] |
| InChI | InChI=1S/C18H19.2ClH.Zr/c1-11-12(2)14(4)18(13(11)3)17-10-9-15-7-5-6-8-16(15)17;;;/h5-10,17H,1-4H3;2*1H;/q-1;;;+4/p-2 |
| InChIKey | NLTGIXQLAAYHCC-UHFFFAOYSA-L |
| XLogP | -1.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|