C20H23Ti+ — CID 154453522
ethylidenetitanium(2+);1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-1H-indene (PubChem CID 154453522) has the molecular formula C20H23Ti+ and a molecular weight of 311.27 g/mol. Its IUPAC name is ethylidenetitanium(2+);1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-1H-indene.
| Compound Name | ethylidenetitanium(2+);1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-1H-indene |
|---|---|
| PubChem CID | 154453522 |
| Molecular Formula | C20H23Ti+ |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | ethylidenetitanium(2+);1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-1H-indene |
| SMILES | CC=[Ti+2].Cc1c(C)c(C)[c-](C2C=Cc3ccccc32)c1C |
| InChI | InChI=1S/C18H19.C2H4.Ti/c1-11-12(2)14(4)18(13(11)3)17-10-9-15-7-5-6-8-16(15)17;1-2;/h5-10,17H,1-4H3;1H,2H3;/q-1;;+2 |
| InChIKey | RSHKHSUKBQGMEW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|