About dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride
dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride (PubChem CID 87402290) has the molecular formula C21H21ClSiTi
and a molecular weight of 384.81 g/mol. Its IUPAC name is dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride.
Molecular Properties
| Compound Name | dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride |
| PubChem CID | 87402290 |
| Molecular Formula | C21H21ClSiTi |
| Molecular Weight | 384.81 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride |
| SMILES | C1=CC([CH-]C2C=Cc3ccccc32)c2ccccc21.C[Si](C)=[Ti+2].[Cl-] |
| InChI | InChI=1S/C19H15.C2H6Si.ClH.Ti/c1-3-7-18-14(5-1)9-11-16(18)13-17-12-10-15-6-2-4-8-19(15)17;1-3-2;;/h1-13,16-17H;1-2H3;1H;/q-1;;;+2/p-1 |
| InChIKey | UOKCZIWYGYMHNV-UHFFFAOYSA-M |
| XLogP | 2.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride?
The IUPAC name of dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride (CID 87402290) is dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride.
What is the SMILES notation for dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride?
The canonical SMILES for dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride is C1=CC([CH-]C2C=Cc3ccccc32)c2ccccc21.C[Si](C)=[Ti+2].[Cl-].
What is the InChIKey of dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride?
The InChIKey is UOKCZIWYGYMHNV-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H15.C2H6Si.ClH.Ti/c1-3-7-18-14(5-1)9-11-16(18)13-17-12-10-15-6-2-4-8-19(15)17;1-3-2;;/h1-13,16-17H;1-2H3;1H;/q-1;;;+2/p-1.
What are the key properties of dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride?
dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride has a molecular weight of 384.81 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilylidenetitanium(2+);1-(1H-inden-1-ylmethyl)-1H-indene;chloride is sourced from PubChem (CID 87402290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).