C9H20N2O2-2 — CID 163872059
2-N,6-N-dimethyl-2-N,6-N-dioxidoheptane-2,6-diamine (PubChem CID 163872059) has the molecular formula C9H20N2O2-2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-N,6-N-dimethyl-2-N,6-N-dioxidoheptane-2,6-diamine.
| Compound Name | 2-N,6-N-dimethyl-2-N,6-N-dioxidoheptane-2,6-diamine |
|---|---|
| PubChem CID | 163872059 |
| Molecular Formula | C9H20N2O2-2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 2-N,6-N-dimethyl-2-N,6-N-dioxidoheptane-2,6-diamine |
| SMILES | CC(CCCC(C)N(C)[O-])N(C)[O-] |
| InChI | InChI=1S/C9H20N2O2/c1-8(10(3)12)6-5-7-9(2)11(4)13/h8-9H,5-7H2,1-4H3/q-2 |
| InChIKey | FAUCJJHZQRPXJH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|