About CID 163872370
CID 163872370 (PubChem CID 163872370) has the molecular formula C14H19BFNO2
and a molecular weight of 263.12 g/mol.
Molecular Properties
| Compound Name | CID 163872370 |
| PubChem CID | 163872370 |
| Molecular Formula | C14H19BFNO2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | — |
| SMILES | [B]c1c(C)cc(N(CCOCCF)C(C)=O)cc1C |
| InChI | InChI=1S/C14H19BFNO2/c1-10-8-13(9-11(2)14(10)15)17(12(3)18)5-7-19-6-4-16/h8-9H,4-7H2,1-3H3 |
| InChIKey | KTALXPSPXJIPGQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163872370 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163872370?
The IUPAC name of CID 163872370 (CID 163872370) is not available.
What is the SMILES notation for CID 163872370?
The canonical SMILES for CID 163872370 is [B]c1c(C)cc(N(CCOCCF)C(C)=O)cc1C.
What is the InChIKey of CID 163872370?
The InChIKey is KTALXPSPXJIPGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BFNO2/c1-10-8-13(9-11(2)14(10)15)17(12(3)18)5-7-19-6-4-16/h8-9H,4-7H2,1-3H3.
What are the key properties of CID 163872370?
CID 163872370 has a molecular weight of 263.12 g/mol, XLogP of 1.44, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163872370 is sourced from PubChem (CID 163872370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).