C10H18NO2+ — CID 163876059
[3-(carboxymethyl)-4,4-dimethylpentylidene]-methylideneazanium (PubChem CID 163876059) has the molecular formula C10H18NO2+ and a molecular weight of 184.26 g/mol. Its IUPAC name is [3-(carboxymethyl)-4,4-dimethylpentylidene]-methylideneazanium.
| Compound Name | [3-(carboxymethyl)-4,4-dimethylpentylidene]-methylideneazanium |
|---|---|
| PubChem CID | 163876059 |
| Molecular Formula | C10H18NO2+ |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | [3-(carboxymethyl)-4,4-dimethylpentylidene]-methylideneazanium |
| SMILES | C=[N+]=CCC(CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H17NO2/c1-10(2,3)8(5-6-11-4)7-9(12)13/h6,8H,4-5,7H2,1-3H3/p+1 |
| InChIKey | UZIOWEQAXKQXJJ-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 51.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|