C21H19N3O2 — CID 163880214
2-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]-5-prop-1-en-2-ylaniline (PubChem CID 163880214) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]-5-prop-1-en-2-ylaniline.
| Compound Name | 2-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]-5-prop-1-en-2-ylaniline |
|---|---|
| PubChem CID | 163880214 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]-5-prop-1-en-2-ylaniline |
| SMILES | C=C(C)c1ccc(-c2noc(-c3cc4c(C)ccc(C)c4o3)n2)c(N)c1 |
| InChI | InChI=1S/C21H19N3O2/c1-11(2)14-7-8-15(17(22)9-14)20-23-21(26-24-20)18-10-16-12(3)5-6-13(4)19(16)25-18/h5-10H,1,22H2,2-4H3 |
| InChIKey | PSNFSIKMPDJCQF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|