C20H17N3O4 — CID 121414266
methyl 3-amino-4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 121414266) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is methyl 3-amino-4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | methyl 3-amino-4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 121414266 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | methyl 3-amino-4-[5-(4,7-dimethyl-1-benzofuran-2-yl)-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2noc(-c3cc4c(C)ccc(C)c4o3)n2)c(N)c1 |
| InChI | InChI=1S/C20H17N3O4/c1-10-4-5-11(2)17-14(10)9-16(26-17)19-22-18(23-27-19)13-7-6-12(8-15(13)21)20(24)25-3/h4-9H,21H2,1-3H3 |
| InChIKey | QVLOXOMKMNHZGH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|