C22H24O8 — CID 163881060
[4-(4,4-dihydroxybutanoyloxy)-2,3-bis(ethenyl)naphthalen-1-yl] 4,4-dihydroxybutanoate (PubChem CID 163881060) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is [4-(4,4-dihydroxybutanoyloxy)-2,3-bis(ethenyl)naphthalen-1-yl] 4,4-dihydroxybutanoate.
| Compound Name | [4-(4,4-dihydroxybutanoyloxy)-2,3-bis(ethenyl)naphthalen-1-yl] 4,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 163881060 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [4-(4,4-dihydroxybutanoyloxy)-2,3-bis(ethenyl)naphthalen-1-yl] 4,4-dihydroxybutanoate |
| SMILES | C=Cc1c(C=C)c(OC(=O)CCC(O)O)c2ccccc2c1OC(=O)CCC(O)O |
| InChI | InChI=1S/C22H24O8/c1-3-13-14(4-2)22(30-20(28)12-10-18(25)26)16-8-6-5-7-15(16)21(13)29-19(27)11-9-17(23)24/h3-8,17-18,23-26H,1-2,9-12H2 |
| InChIKey | PTFSQQIOIUDVFR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|