C20H19F4N5O3S — CID 163881932
3-[2-amino-6-(4-fluorophenyl)-5-[2-methyl-6-(trifluoromethyl)-4-pyridinyl]pyrimidin-4-yl]oxypropane-1-sulfonamide (PubChem CID 163881932) has the molecular formula C20H19F4N5O3S and a molecular weight of 485.46 g/mol. Its IUPAC name is 3-[2-amino-6-(4-fluorophenyl)-5-[2-methyl-6-(trifluoromethyl)-4-pyridinyl]pyrimidin-4-yl]oxypropane-1-sulfonamide.
| Compound Name | 3-[2-amino-6-(4-fluorophenyl)-5-[2-methyl-6-(trifluoromethyl)-4-pyridinyl]pyrimidin-4-yl]oxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 163881932 |
| Molecular Formula | C20H19F4N5O3S |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 3-[2-amino-6-(4-fluorophenyl)-5-[2-methyl-6-(trifluoromethyl)-4-pyridinyl]pyrimidin-4-yl]oxypropane-1-sulfonamide |
| SMILES | Cc1cc(-c2c(OCCCS(N)(=O)=O)nc(N)nc2-c2ccc(F)cc2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H19F4N5O3S/c1-11-9-13(10-15(27-11)20(22,23)24)16-17(12-3-5-14(21)6-4-12)28-19(25)29-18(16)32-7-2-8-33(26,30)31/h3-6,9-10H,2,7-8H2,1H3,(H2,25,28,29)(H2,26,30,31) |
| InChIKey | PTZKDFDCWNEZQU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|