C9H17NS — CID 163883374
S-[(2S,3S)-3-cyclobutylpent-4-en-2-yl]thiohydroxylamine (PubChem CID 163883374) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is S-[(2S,3S)-3-cyclobutylpent-4-en-2-yl]thiohydroxylamine.
| Compound Name | S-[(2S,3S)-3-cyclobutylpent-4-en-2-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 163883374 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | S-[(2S,3S)-3-cyclobutylpent-4-en-2-yl]thiohydroxylamine |
| SMILES | C=C[C@@H](C1CCC1)[C@H](C)SN |
| InChI | InChI=1S/C9H17NS/c1-3-9(7(2)11-10)8-5-4-6-8/h3,7-9H,1,4-6,10H2,2H3/t7-,9+/m0/s1 |
| InChIKey | PVFOMWPIAMVHGN-IONNQARKSA-N |
| XLogP | 2.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|