C14H25NO — CID 174948640
3-cycloheptyl-2-ethylpent-4-enamide (PubChem CID 174948640) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 3-cycloheptyl-2-ethylpent-4-enamide.
| Compound Name | 3-cycloheptyl-2-ethylpent-4-enamide |
|---|---|
| PubChem CID | 174948640 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 3-cycloheptyl-2-ethylpent-4-enamide |
| SMILES | C=CC(C1CCCCCC1)C(CC)C(N)=O |
| InChI | InChI=1S/C14H25NO/c1-3-12(13(4-2)14(15)16)11-9-7-5-6-8-10-11/h3,11-13H,1,4-10H2,2H3,(H2,15,16) |
| InChIKey | ZPHWTXKZQWDZKZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|