C18H20N2O6 — CID 163885099
2-[[5-hydroxy-8-methyl-3-[(2S)-oxan-2-yl]-7-oxo-8H-quinoline-6-carbonyl]amino]acetic acid (PubChem CID 163885099) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-[[5-hydroxy-8-methyl-3-[(2S)-oxan-2-yl]-7-oxo-8H-quinoline-6-carbonyl]amino]acetic acid.
| Compound Name | 2-[[5-hydroxy-8-methyl-3-[(2S)-oxan-2-yl]-7-oxo-8H-quinoline-6-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 163885099 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[[5-hydroxy-8-methyl-3-[(2S)-oxan-2-yl]-7-oxo-8H-quinoline-6-carbonyl]amino]acetic acid |
| SMILES | CC1C(=O)C(C(=O)NCC(=O)O)=C(O)c2cc([C@@H]3CCCCO3)cnc21 |
| InChI | InChI=1S/C18H20N2O6/c1-9-15-11(6-10(7-19-15)12-4-2-3-5-26-12)17(24)14(16(9)23)18(25)20-8-13(21)22/h6-7,9,12,24H,2-5,8H2,1H3,(H,20,25)(H,21,22)/t9?,12-/m0/s1 |
| InChIKey | PWQNRDVVGABUEB-ACGXKRRESA-N |
| XLogP | 1.48 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|