C25H29N7O3S — CID 163886557
1-[3-[1-amino-1-(2-aminopyrimidin-4-yl)-3-tert-butyliminoprop-1-en-2-yl]phenyl]-3-(4-methylsulfonylphenyl)urea (PubChem CID 163886557) has the molecular formula C25H29N7O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is 1-[3-[1-amino-1-(2-aminopyrimidin-4-yl)-3-tert-butyliminoprop-1-en-2-yl]phenyl]-3-(4-methylsulfonylphenyl)urea.
| Compound Name | 1-[3-[1-amino-1-(2-aminopyrimidin-4-yl)-3-tert-butyliminoprop-1-en-2-yl]phenyl]-3-(4-methylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 163886557 |
| Molecular Formula | C25H29N7O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 1-[3-[1-amino-1-(2-aminopyrimidin-4-yl)-3-tert-butyliminoprop-1-en-2-yl]phenyl]-3-(4-methylsulfonylphenyl)urea |
| SMILES | CC(C)(C)/N=C/C(=C(N)c1ccnc(N)n1)c1cccc(NC(=O)Nc2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C25H29N7O3S/c1-25(2,3)29-15-20(22(26)21-12-13-28-23(27)32-21)16-6-5-7-18(14-16)31-24(33)30-17-8-10-19(11-9-17)36(4,34)35/h5-15H,26H2,1-4H3,(H2,27,28,32)(H2,30,31,33)/b22-20?,29-15+ |
| InChIKey | OMAFKACABBXBKY-RWHREPNXSA-N |
| XLogP | 3.80 |
| TPSA | 165.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|