C25H29N7O — CID 147120029
1-[3-[1-amino-1-(2-aminopyrimidin-4-yl)-3-tert-butyliminoprop-1-en-2-yl]phenyl]-3-(4-methylphenyl)urea (PubChem CID 147120029) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is 1-[3-[1-amino-1-(2-aminopyrimidin-4-yl)-3-tert-butyliminoprop-1-en-2-yl]phenyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[3-[1-amino-1-(2-aminopyrimidin-4-yl)-3-tert-butyliminoprop-1-en-2-yl]phenyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 147120029 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 1-[3-[1-amino-1-(2-aminopyrimidin-4-yl)-3-tert-butyliminoprop-1-en-2-yl]phenyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cccc(C(/C=N/C(C)(C)C)=C(N)c3ccnc(N)n3)c2)cc1 |
| InChI | InChI=1S/C25H29N7O/c1-16-8-10-18(11-9-16)30-24(33)31-19-7-5-6-17(14-19)20(15-29-25(2,3)4)22(26)21-12-13-28-23(27)32-21/h5-15H,26H2,1-4H3,(H2,27,28,32)(H2,30,31,33)/b22-20?,29-15+ |
| InChIKey | XRVWZUXCMFTDOC-RWHREPNXSA-N |
| XLogP | 4.71 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|