C25H33N3NiO6 — CID 163887544
tert-butyl (6S)-2-amino-6,7-bis[(2,3-dihydroxyphenyl)methylideneamino]heptanoate;nickel (PubChem CID 163887544) has the molecular formula C25H33N3NiO6 and a molecular weight of 530.25 g/mol. Its IUPAC name is tert-butyl (6S)-2-amino-6,7-bis[(2,3-dihydroxyphenyl)methylideneamino]heptanoate;nickel.
| Compound Name | tert-butyl (6S)-2-amino-6,7-bis[(2,3-dihydroxyphenyl)methylideneamino]heptanoate;nickel |
|---|---|
| PubChem CID | 163887544 |
| Molecular Formula | C25H33N3NiO6 |
| Molecular Weight | 530.25 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | tert-butyl (6S)-2-amino-6,7-bis[(2,3-dihydroxyphenyl)methylideneamino]heptanoate;nickel |
| SMILES | CC(C)(C)OC(=O)C(N)CCC[C@@H](C/N=C/c1cccc(O)c1O)/N=C/c1cccc(O)c1O.[Ni] |
| InChI | InChI=1S/C25H33N3O6.Ni/c1-25(2,3)34-24(33)19(26)10-6-9-18(28-14-17-8-5-12-21(30)23(17)32)15-27-13-16-7-4-11-20(29)22(16)31;/h4-5,7-8,11-14,18-19,29-32H,6,9-10,15,26H2,1-3H3;/b27-13+,28-14+;/t18-,19?;/m0./s1 |
| InChIKey | PYSHRYSOELDJQI-UMMZWATPSA-N |
| XLogP | 3.25 |
| TPSA | 157.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|