C20H25CuN3O2 — CID 135548165
2-[[(2S)-6-amino-2-[(2-hydroxyphenyl)methylideneamino]hexyl]iminomethyl]phenol;copper (PubChem CID 135548165) has the molecular formula C20H25CuN3O2 and a molecular weight of 402.99 g/mol. Its IUPAC name is 2-[[(2S)-6-amino-2-[(2-hydroxyphenyl)methylideneamino]hexyl]iminomethyl]phenol;copper.
| Compound Name | 2-[[(2S)-6-amino-2-[(2-hydroxyphenyl)methylideneamino]hexyl]iminomethyl]phenol;copper |
|---|---|
| PubChem CID | 135548165 |
| Molecular Formula | C20H25CuN3O2 |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[[(2S)-6-amino-2-[(2-hydroxyphenyl)methylideneamino]hexyl]iminomethyl]phenol;copper |
| SMILES | NCCCC[C@@H](C/N=C/c1ccccc1O)/N=C/c1ccccc1O.[Cu] |
| InChI | InChI=1S/C20H25N3O2.Cu/c21-12-6-5-9-18(23-14-17-8-2-4-11-20(17)25)15-22-13-16-7-1-3-10-19(16)24;/h1-4,7-8,10-11,13-14,18,24-25H,5-6,9,12,15,21H2;/b22-13+,23-14+;/t18-;/m0./s1 |
| InChIKey | NQVYZNYTKRUKSD-AXEDNSEPSA-N |
| XLogP | 3.13 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|