C18H19ClF2N4O2 — CID 163889771
cyclopropanecarbonyl chloride;4-fluoropyridin-2-amine;N-(4-fluoro-2-pyridinyl)cyclopropanecarboxamide (PubChem CID 163889771) has the molecular formula C18H19ClF2N4O2 and a molecular weight of 396.83 g/mol. Its IUPAC name is cyclopropanecarbonyl chloride;4-fluoropyridin-2-amine;N-(4-fluoro-2-pyridinyl)cyclopropanecarboxamide.
| Compound Name | cyclopropanecarbonyl chloride;4-fluoropyridin-2-amine;N-(4-fluoro-2-pyridinyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 163889771 |
| Molecular Formula | C18H19ClF2N4O2 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | cyclopropanecarbonyl chloride;4-fluoropyridin-2-amine;N-(4-fluoro-2-pyridinyl)cyclopropanecarboxamide |
| SMILES | Nc1cc(F)ccn1.O=C(Cl)C1CC1.O=C(Nc1cc(F)ccn1)C1CC1 |
| InChI | InChI=1S/C9H9FN2O.C5H5FN2.C4H5ClO/c10-7-3-4-11-8(5-7)12-9(13)6-1-2-6;6-4-1-2-8-5(7)3-4;5-4(6)3-1-2-3/h3-6H,1-2H2,(H,11,12,13);1-3H,(H2,7,8);3H,1-2H2 |
| InChIKey | QAOBLLOAFKTTDY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|