C23H26FNO — CID 163890575
6-cyclopropyl-1-(8-fluoroquinolin-3-yl)-3-methyl-3-(2-methylpropyl)hex-5-yn-2-one (PubChem CID 163890575) has the molecular formula C23H26FNO and a molecular weight of 351.47 g/mol. Its IUPAC name is 6-cyclopropyl-1-(8-fluoroquinolin-3-yl)-3-methyl-3-(2-methylpropyl)hex-5-yn-2-one.
| Compound Name | 6-cyclopropyl-1-(8-fluoroquinolin-3-yl)-3-methyl-3-(2-methylpropyl)hex-5-yn-2-one |
|---|---|
| PubChem CID | 163890575 |
| Molecular Formula | C23H26FNO |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 6-cyclopropyl-1-(8-fluoroquinolin-3-yl)-3-methyl-3-(2-methylpropyl)hex-5-yn-2-one |
| SMILES | CC(C)CC(C)(CC#CC1CC1)C(=O)Cc1cnc2c(F)cccc2c1 |
| InChI | InChI=1S/C23H26FNO/c1-16(2)14-23(3,11-5-6-17-9-10-17)21(26)13-18-12-19-7-4-8-20(24)22(19)25-15-18/h4,7-8,12,15-17H,9-11,13-14H2,1-3H3 |
| InChIKey | BXHFTSHSODZMRU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|