C17H14N4O4 — CID 163891805
N-[3-[5-(hydroxymethyl)-1,3,4-oxadiazol-2-yl]cyclobutylidene]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 163891805) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is N-[3-[5-(hydroxymethyl)-1,3,4-oxadiazol-2-yl]cyclobutylidene]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-[5-(hydroxymethyl)-1,3,4-oxadiazol-2-yl]cyclobutylidene]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 163891805 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-[3-[5-(hydroxymethyl)-1,3,4-oxadiazol-2-yl]cyclobutylidene]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(N=C1CC(c2nnc(CO)o2)C1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C17H14N4O4/c22-9-15-19-20-17(24-15)11-6-12(7-11)18-16(23)13-8-14(25-21-13)10-4-2-1-3-5-10/h1-5,8,11,22H,6-7,9H2/b18-12- |
| InChIKey | QCELTXBHRXGHIP-PDGQHHTCSA-N |
| XLogP | 2.38 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|