C17H23N3O2 — CID 163894620
tert-butyl N-[[3-[(Z)-1-(aziridin-2-yl)-3-iminoprop-1-en-2-yl]phenyl]methyl]carbamate (PubChem CID 163894620) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl N-[[3-[(Z)-1-(aziridin-2-yl)-3-iminoprop-1-en-2-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[(Z)-1-(aziridin-2-yl)-3-iminoprop-1-en-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 163894620 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | tert-butyl N-[[3-[(Z)-1-(aziridin-2-yl)-3-iminoprop-1-en-2-yl]phenyl]methyl]carbamate |
| SMILES | [H]/N=C/C(=C\C1CN1)c1cccc(CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H23N3O2/c1-17(2,3)22-16(21)20-10-12-5-4-6-13(7-12)14(9-18)8-15-11-19-15/h4-9,15,18-19H,10-11H2,1-3H3,(H,20,21)/b14-8+,18-9+ |
| InChIKey | QENOBPDSLOPGGW-HECFVYJASA-N |
| XLogP | 2.72 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|