C5H14N2O3+2 — CID 163895024
(2-acetamido-3-hydroxy-1-oxoniopropyl)azanium (PubChem CID 163895024) has the molecular formula C5H14N2O3+2 and a molecular weight of 150.18 g/mol. Its IUPAC name is (2-acetamido-3-hydroxy-1-oxoniopropyl)azanium.
| Compound Name | (2-acetamido-3-hydroxy-1-oxoniopropyl)azanium |
|---|---|
| PubChem CID | 163895024 |
| Molecular Formula | C5H14N2O3+2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (2-acetamido-3-hydroxy-1-oxoniopropyl)azanium |
| SMILES | CC(=O)NC(CO)C([NH3+])[OH2+] |
| InChI | InChI=1S/C5H12N2O3/c1-3(9)7-4(2-8)5(6)10/h4-5,8,10H,2,6H2,1H3,(H,7,9)/p+2 |
| InChIKey | QEWGAQGTEBTCRM-UHFFFAOYSA-P |
| XLogP | -3.22 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|