About [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide
[cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide (PubChem CID 163897327) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide.
Molecular Properties
| Compound Name | [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide |
| PubChem CID | 163897327 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide |
| SMILES | C[NH+]([NH-])C1C=CC=C1 |
| InChI | InChI=1S/C6H10N2/c1-8(7)6-4-2-3-5-6/h2-8H,1H3 |
| InChIKey | QGUPMDWGQFJNAX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 28.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide?
The IUPAC name of [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide (CID 163897327) is [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide.
What is the SMILES notation for [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide?
The canonical SMILES for [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide is C[NH+]([NH-])C1C=CC=C1.
What is the InChIKey of [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide?
The InChIKey is QGUPMDWGQFJNAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-8(7)6-4-2-3-5-6/h2-8H,1H3.
What are the key properties of [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide?
[cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide has a molecular weight of 110.16 g/mol, XLogP of -0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclopenta-2,4-dien-1-yl(methyl)azaniumyl]azanide is sourced from PubChem (CID 163897327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).