C23H34N2O9 — CID 163901396
6,7-dimethyl-3-oxo-4-[(2R,3S,4S)-2,4,5-tris(methoxymethoxy)-3-methylpentyl]quinoxaline-2-carboxylic acid (PubChem CID 163901396) has the molecular formula C23H34N2O9 and a molecular weight of 482.53 g/mol. Its IUPAC name is 6,7-dimethyl-3-oxo-4-[(2R,3S,4S)-2,4,5-tris(methoxymethoxy)-3-methylpentyl]quinoxaline-2-carboxylic acid.
| Compound Name | 6,7-dimethyl-3-oxo-4-[(2R,3S,4S)-2,4,5-tris(methoxymethoxy)-3-methylpentyl]quinoxaline-2-carboxylic acid |
|---|---|
| PubChem CID | 163901396 |
| Molecular Formula | C23H34N2O9 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 6,7-dimethyl-3-oxo-4-[(2R,3S,4S)-2,4,5-tris(methoxymethoxy)-3-methylpentyl]quinoxaline-2-carboxylic acid |
| SMILES | COCOC[C@@H](OCOC)[C@@H](C)[C@H](Cn1c(=O)c(C(=O)O)nc2cc(C)c(C)cc21)OCOC |
| InChI | InChI=1S/C23H34N2O9/c1-14-7-17-18(8-15(14)2)25(22(26)21(24-17)23(27)28)9-19(33-12-30-5)16(3)20(34-13-31-6)10-32-11-29-4/h7-8,16,19-20H,9-13H2,1-6H3,(H,27,28)/t16-,19-,20+/m0/s1 |
| InChIKey | BZQNSVRBQGBDAL-FFZOFVMBSA-N |
| XLogP | 1.95 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|