C18H16OS — CID 163902949
1-(2,4-dimethylphenyl)sulfanylnaphthalen-2-ol (PubChem CID 163902949) has the molecular formula C18H16OS and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)sulfanylnaphthalen-2-ol.
| Compound Name | 1-(2,4-dimethylphenyl)sulfanylnaphthalen-2-ol |
|---|---|
| PubChem CID | 163902949 |
| Molecular Formula | C18H16OS |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-(2,4-dimethylphenyl)sulfanylnaphthalen-2-ol |
| SMILES | Cc1ccc(Sc2c(O)ccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C18H16OS/c1-12-7-10-17(13(2)11-12)20-18-15-6-4-3-5-14(15)8-9-16(18)19/h3-11,19H,1-2H3 |
| InChIKey | QLLUVGKMWKIUMY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |