C20H14N4O — CID 163903684
2-imino-2-pyridin-3-yl-1-(4-pyrrolo[2,3-b]pyridin-1-ylphenyl)ethanone (PubChem CID 163903684) has the molecular formula C20H14N4O and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-imino-2-pyridin-3-yl-1-(4-pyrrolo[2,3-b]pyridin-1-ylphenyl)ethanone.
| Compound Name | 2-imino-2-pyridin-3-yl-1-(4-pyrrolo[2,3-b]pyridin-1-ylphenyl)ethanone |
|---|---|
| PubChem CID | 163903684 |
| Molecular Formula | C20H14N4O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-imino-2-pyridin-3-yl-1-(4-pyrrolo[2,3-b]pyridin-1-ylphenyl)ethanone |
| SMILES | [H]/N=C(/C(=O)c1ccc(-n2ccc3cccnc32)cc1)c1cccnc1 |
| InChI | InChI=1S/C20H14N4O/c21-18(16-4-1-10-22-13-16)19(25)14-5-7-17(8-6-14)24-12-9-15-3-2-11-23-20(15)24/h1-13,21H/b21-18+ |
| InChIKey | QMAYYDNSZGPGLD-DYTRJAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|