C27H38IN5O3 — CID 163905770
[4-[(1-acetamido-2-methylhexan-2-yl)amino]quinazolin-2-yl]-[(2,4-dimethoxyphenyl)methyl]-methyliodanuidylazanium (PubChem CID 163905770) has the molecular formula C27H38IN5O3 and a molecular weight of 607.54 g/mol. Its IUPAC name is [4-[(1-acetamido-2-methylhexan-2-yl)amino]quinazolin-2-yl]-[(2,4-dimethoxyphenyl)methyl]-methyliodanuidylazanium.
| Compound Name | [4-[(1-acetamido-2-methylhexan-2-yl)amino]quinazolin-2-yl]-[(2,4-dimethoxyphenyl)methyl]-methyliodanuidylazanium |
|---|---|
| PubChem CID | 163905770 |
| Molecular Formula | C27H38IN5O3 |
| Molecular Weight | 607.54 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | [4-[(1-acetamido-2-methylhexan-2-yl)amino]quinazolin-2-yl]-[(2,4-dimethoxyphenyl)methyl]-methyliodanuidylazanium |
| SMILES | CCCCC(C)(CNC(C)=O)Nc1nc([NH+](Cc2ccc(OC)cc2OC)[I-]C)nc2ccccc12 |
| InChI | InChI=1S/C27H38IN5O3/c1-7-8-15-27(3,18-29-19(2)34)32-25-22-11-9-10-12-23(22)30-26(31-25)33(28-4)17-20-13-14-21(35-5)16-24(20)36-6/h9-14,16,33H,7-8,15,17-18H2,1-6H3,(H,29,34)(H,30,31,32) |
| InChIKey | QNTRQMFEYNOBJV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.54 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|