C22H20N4O3 — CID 163909533
6-(1H-indol-4-ylmethyl)-2-N-methyl-4-N-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-ylidene]pyridine-2,4-dicarboxamide (PubChem CID 163909533) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 6-(1H-indol-4-ylmethyl)-2-N-methyl-4-N-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-ylidene]pyridine-2,4-dicarboxamide.
| Compound Name | 6-(1H-indol-4-ylmethyl)-2-N-methyl-4-N-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-ylidene]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 163909533 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 6-(1H-indol-4-ylmethyl)-2-N-methyl-4-N-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-ylidene]pyridine-2,4-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)/N=C2/[C@H]3COC[C@@H]23)cc(Cc2cccc3[nH]ccc23)n1 |
| InChI | InChI=1S/C22H20N4O3/c1-23-22(28)19-9-13(21(27)26-20-16-10-29-11-17(16)20)8-14(25-19)7-12-3-2-4-18-15(12)5-6-24-18/h2-6,8-9,16-17,24H,7,10-11H2,1H3,(H,23,28)/b26-20-/t16-,17+/m0/s1 |
| InChIKey | QQWXSOBCOANACB-NIQCQZRNSA-N |
| XLogP | 2.37 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|