C15H20B2I2NO2- — CID 163909686
CID 163909686 (PubChem CID 163909686) has the molecular formula C15H20B2I2NO2- and a molecular weight of 521.76 g/mol.
| Compound Name | CID 163909686 |
|---|---|
| PubChem CID | 163909686 |
| Molecular Formula | C15H20B2I2NO2- |
| Molecular Weight | 521.76 g/mol |
| Exact Mass | 521.98 |
| IUPAC Name | — |
| SMILES | O=C(OC1(C2CC3CCC2C3)CCCC1)C1(C23[B]I2[B]3)N[I-]1 |
| InChI | InChI=1S/C15H20B2I2NO2/c21-12(14(18-20-14)15-16-19(15)17-15)22-13(5-1-2-6-13)11-8-9-3-4-10(11)7-9/h9-11,20H,1-8H2/q-1 |
| InChIKey | BFTBIKNFUKKGMP-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.76 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|