C17H28O2 — CID 21131318
[1-(2-bicyclo[2.2.1]heptanyl)cyclopentyl] 2-methylbutanoate (PubChem CID 21131318) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is [1-(2-bicyclo[2.2.1]heptanyl)cyclopentyl] 2-methylbutanoate.
| Compound Name | [1-(2-bicyclo[2.2.1]heptanyl)cyclopentyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 21131318 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | [1-(2-bicyclo[2.2.1]heptanyl)cyclopentyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1(C2CC3CCC2C3)CCCC1 |
| InChI | InChI=1S/C17H28O2/c1-3-12(2)16(18)19-17(8-4-5-9-17)15-11-13-6-7-14(15)10-13/h12-15H,3-11H2,1-2H3 |
| InChIKey | PXESJOKEZVNFOE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |