About [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate
[5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate (PubChem CID 121423046) has the molecular formula C22H36O4
and a molecular weight of 364.53 g/mol. Its IUPAC name is [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate |
| PubChem CID | 121423046 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC2CC1C(C1(O)CCCC1)C2C1(O)CCCC1 |
| InChI | InChI=1S/C22H36O4/c1-3-14(2)20(23)26-17-13-15-12-16(17)19(22(25)10-6-7-11-22)18(15)21(24)8-4-5-9-21/h14-19,24-25H,3-13H2,1-2H3 |
| InChIKey | ADBXJXCLFBIVFF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate?
The IUPAC name of [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate (CID 121423046) is [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate.
What is the SMILES notation for [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate?
The canonical SMILES for [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate is CCC(C)C(=O)OC1CC2CC1C(C1(O)CCCC1)C2C1(O)CCCC1.
What is the InChIKey of [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate?
The InChIKey is ADBXJXCLFBIVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36O4/c1-3-14(2)20(23)26-17-13-15-12-16(17)19(22(25)10-6-7-11-22)18(15)21(24)8-4-5-9-21/h14-19,24-25H,3-13H2,1-2H3.
What are the key properties of [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate?
[5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate has a molecular weight of 364.53 g/mol, XLogP of 3.83, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate is sourced from PubChem (CID 121423046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).