C14H20F4O2 — CID 122680780
[5-(1,1,2,2-tetrafluoroethyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate (PubChem CID 122680780) has the molecular formula C14H20F4O2 and a molecular weight of 296.30 g/mol. Its IUPAC name is [5-(1,1,2,2-tetrafluoroethyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate.
| Compound Name | [5-(1,1,2,2-tetrafluoroethyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 122680780 |
| Molecular Formula | C14H20F4O2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [5-(1,1,2,2-tetrafluoroethyl)-2-bicyclo[2.2.1]heptanyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC2CC1CC2C(F)(F)C(F)F |
| InChI | InChI=1S/C14H20F4O2/c1-3-7(2)12(19)20-11-6-8-4-9(11)5-10(8)14(17,18)13(15)16/h7-11,13H,3-6H2,1-2H3 |
| InChIKey | GEBXVUUISWMWML-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|