C19H28O9 — CID 59660463
[3,4-bis(2-hydroxypropanoyloxy)-8-tricyclo[5.2.1.02,6]decanyl] 2-hydroxypropanoate (PubChem CID 59660463) has the molecular formula C19H28O9 and a molecular weight of 400.42 g/mol. Its IUPAC name is [3,4-bis(2-hydroxypropanoyloxy)-8-tricyclo[5.2.1.02,6]decanyl] 2-hydroxypropanoate.
| Compound Name | [3,4-bis(2-hydroxypropanoyloxy)-8-tricyclo[5.2.1.02,6]decanyl] 2-hydroxypropanoate |
|---|---|
| PubChem CID | 59660463 |
| Molecular Formula | C19H28O9 |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [3,4-bis(2-hydroxypropanoyloxy)-8-tricyclo[5.2.1.02,6]decanyl] 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OC1CC2CC1C1CC(OC(=O)C(C)O)C(OC(=O)C(C)O)C21 |
| InChI | InChI=1S/C19H28O9/c1-7(20)17(23)26-13-5-10-4-11(13)12-6-14(27-18(24)8(2)21)16(15(10)12)28-19(25)9(3)22/h7-16,20-22H,4-6H2,1-3H3 |
| InChIKey | JDRIYCPNTMWSEL-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|