About cyclopent-3-en-1-yl 2-hydroxypropanoate
cyclopent-3-en-1-yl 2-hydroxypropanoate (PubChem CID 22150875) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is cyclopent-3-en-1-yl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | cyclopent-3-en-1-yl 2-hydroxypropanoate |
| PubChem CID | 22150875 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | cyclopent-3-en-1-yl 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OC1CC=CC1 |
| InChI | InChI=1S/C8H12O3/c1-6(9)8(10)11-7-4-2-3-5-7/h2-3,6-7,9H,4-5H2,1H3 |
| InChIKey | VXSQZJZKVHAWFV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopent-3-en-1-yl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopent-3-en-1-yl 2-hydroxypropanoate?
The IUPAC name of cyclopent-3-en-1-yl 2-hydroxypropanoate (CID 22150875) is cyclopent-3-en-1-yl 2-hydroxypropanoate.
What is the SMILES notation for cyclopent-3-en-1-yl 2-hydroxypropanoate?
The canonical SMILES for cyclopent-3-en-1-yl 2-hydroxypropanoate is CC(O)C(=O)OC1CC=CC1.
What is the InChIKey of cyclopent-3-en-1-yl 2-hydroxypropanoate?
The InChIKey is VXSQZJZKVHAWFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-6(9)8(10)11-7-4-2-3-5-7/h2-3,6-7,9H,4-5H2,1H3.
What are the key properties of cyclopent-3-en-1-yl 2-hydroxypropanoate?
cyclopent-3-en-1-yl 2-hydroxypropanoate has a molecular weight of 156.18 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopent-3-en-1-yl 2-hydroxypropanoate is sourced from PubChem (CID 22150875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).